MCQOPTIONS
Saved Bookmarks
MCQOPTIONS
This section includes 657 Mcqs, each offering curated multiple-choice questions to sharpen your Testing Subject knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Chemosynthetic bacteria obtain energy by oxidizing _______ chemical compounds. |
| A. | Organic |
| B. | Inorganic |
| C. | Synthetic |
| D. | Processed |
| Answer» C. Synthetic | |
| 2. |
Shunt generators are generally used for |
| A. | arc welding |
| B. | charging batteries |
| C. | regenerative braking of dc locomotives |
| D. | elevators |
| Answer» C. regenerative braking of dc locomotives | |
| 3. |
The pie chart given here shows the spendings of a country on various sports during a particular year.Study the chart carefully and answer the questions given below it.How much percent less is spent on Football than that on Cricket? |
| A. | \(33\frac{1}{3} %\) % |
| B. | \(12\frac{1}{2} \) % |
| C. | \(20\frac{1}{2} %\) % |
| D. | 25 % |
| Answer» B. \(12\frac{1}{2} \) % | |
| 4. |
Which of the following act entitled India to become a member of Commonwealth Nations? |
| A. | Indian Independence act 1947 |
| B. | Government of India act 1935 |
| C. | Government of India act 1919 |
| D. | Government of India act 1858 |
| Answer» B. Government of India act 1935 | |
| 5. |
The areas of the three adjacent faces of a cuboid are 32 cm2, 24 cm2 and 48 cm2. What is the volume of the cuboid? |
| A. | 128 cm3 |
| B. | 256 cm3 |
| C. | 288 cm3 |
| D. | 192 cm3 |
| Answer» E. | |
| 6. |
Statement: Some spoons are bowls. All bowls are knives. All knives are forks.Conclusion:(I) All spoons are forks(II) All bowls are forks(III) Some knives are bowls(IV) Some forks are spoons |
| A. | Only II, III and IV follow |
| B. | Only II and IV follow |
| C. | Only III and IV follow |
| D. | None of these |
| Answer» B. Only II and IV follow | |
| 7. |
The current market price of a company's share is Rs. 90 and the expected dividend per share next year is Rs. 4.5. If the dividend is expected to grow at a constant rate of 8%, the shareholder's required rate of return will be |
| A. | 8% |
| B. | 5% |
| C. | 20% |
| D. | 13% |
| Answer» E. | |
| 8. |
The famous Belum Caves are in_____ |
| A. | Guntur |
| B. | Kurnool |
| C. | Y.S.R. Kadapa |
| D. | Chittoor |
| Answer» C. Y.S.R. Kadapa | |
| 9. |
What is the enrollment in Botany across university? |
| A. | 100 |
| B. | 105 |
| C. | 120 |
| D. | 125 |
| Answer» B. 105 | |
| 10. |
Which of the following mobile applications won the Platinum under Best Mobile App category in Digital India Awards 2018? |
| A. | Skill Pill |
| B. | eCourts Services |
| C. | Moodle Mobile |
| D. | E.Learning Age |
| Answer» C. Moodle Mobile | |
| 11. |
The product of area and square of distance of centre of gravity of the area from that axis is known as- |
| A. | Second moment of mass |
| B. | Second moment of area |
| C. | First moment of area |
| D. | Mass moment of inertia |
| Answer» C. First moment of area | |
| 12. |
In the following question, two statements are given each followed by two conclusions I and II. You have to consider the statements to be true even if they seem to be at variance from commonly known facts. You have to decide which of the given conclusions, if any, follows from the given statements.Statement:(I) No women can vote.(II) Some women are politicians.Conclusions:(I) Male politicians can vote.(II) Some politicians can vote. |
| A. | Conclusion I follows |
| B. | Conclusion II follows |
| C. | Neither I nor II follows |
| D. | Both I and II follows |
| Answer» D. Both I and II follows | |
| 13. |
The passage is mainly about: |
| A. | The change of the ocean color due to climate change. |
| B. | Why ocean water looks blue. |
| C. | How the growth of phytoplankton will impact the food web |
| D. | The growth of phytoplankton in the ocean. |
| Answer» B. Why ocean water looks blue. | |
| 14. |
The Central Institute of Buddhist studies located at ______ shall be deemed - to - be University provisionally for a period of five years, according to a press release in Jan. 2016. |
| A. | Patna |
| B. | Bodhgaya |
| C. | Leh (Ladakh) |
| D. | Hyderabad |
| Answer» D. Hyderabad | |
| 15. |
Select the word-pair in which the two words are related in the same way as the two words in the following word-pair.Grief : Consolation |
| A. | Pain : Sedative |
| B. | Happiness : Excitation |
| C. | Drought : Famine |
| D. | Planet : Revolution |
| Answer» B. Happiness : Excitation | |
| 16. |
Under which Amendment to the Constitution of India was Goods and Services Tax imposed? |
| A. | 99th |
| B. | 101st |
| C. | 97th |
| D. | 103rd |
| Answer» C. 97th | |
| 17. |
Which generation of computers are based on artificial intelligence? |
| A. | 3rd |
| B. | 5th |
| C. | 2nd |
| D. | 4th |
| Answer» C. 2nd | |
| 18. |
The statement below is followed by two conclusion labelled I and II. You have to assume everything in the statement to be true, and then decide which of the conclusions logically follows for pursuing.Statement: Drinking milk is beneficial for health.Conclusion I: All healthy people drink milk.Conclusion II: Milk is harmful for child. |
| A. | Both conclusions I and II follow. |
| B. | Only conclusion I follows |
| C. | Only conclusion II follows. |
| D. | Neither conclusion I nor conclusion II follows. |
| Answer» E. | |
| 19. |
Which bank launched three new digital products called, UCash, Digilocker and an app in Kolkata, West Bengal in October 2019? |
| A. | Union Bank of India |
| B. | Allahabad Bank |
| C. | Axis Bank |
| D. | UCO Bank |
| E. | HDFC Bank |
| Answer» E. HDFC Bank | |
| 20. |
What day would it be on 29th March 2020? |
| A. | Friday |
| B. | Monday |
| C. | Sunday |
| D. | Saturday |
| Answer» D. Saturday | |
| 21. |
The characteristic impedance η0 of a free space is |
| A. | \(\frac{\mu _0}{\epsilon_0}\) |
| B. | \(\sqrt{\frac{\mu _0}{\epsilon_0}}\) |
| C. | \(\sqrt{\mu_0\epsilon_0}\) |
| D. | μ0ϵ0 |
| Answer» C. \(\sqrt{\mu_0\epsilon_0}\) | |
| 22. |
The broadband system of which satellite received licensing approval for its user terminals from the UK’s communications regulator in January 2021? |
| A. | OneWeb satellite |
| B. | PATH satellite |
| C. | Proba-V satellite |
| D. | Starlink satellite |
| E. | None of the above |
| Answer» E. None of the above | |
| 23. |
What causes Minamata disease? |
| A. | Deficiency of vitamin D |
| B. | Mercury poisoning |
| C. | Viral infection |
| D. | Deformed gene |
| Answer» C. Viral infection | |
| 24. |
Six persons A, B, C, D, E and F are sitting around a roundtable facing the centre. B is seated to the left of D. E is seated to the right of C. A is facing F, who is seated to the left of C. Who is seated to the left of A? |
| A. | E |
| B. | D |
| C. | B |
| D. | C |
| Answer» B. D | |
| 25. |
Which of the following Buddhist literature contains the Buddha’s sermons on matters of ethics and doctrine? |
| A. | Vinayaka Pitaka |
| B. | Jataka Stories |
| C. | Abhidamma Pitaka |
| D. | Sutta Pitaka |
| Answer» E. | |
| 26. |
The price of sugar is increased by 35%. If a person wants to increase his budget by only 10%, by what percentage, corrected to one decimal place, should he decrease his consumption? |
| A. | 16% |
| B. | 17.5% |
| C. | 15% |
| D. | 18.5% |
| Answer» E. | |
| 27. |
To which sport is Santosh Trophy related to? |
| A. | Football |
| B. | Cricket |
| C. | Snooker |
| D. | Basketball |
| E. | Volleyball |
| Answer» B. Cricket | |
| 28. |
Select the most appropriate option of fill in blank No. 4. |
| A. | under |
| B. | on |
| C. | over |
| D. | into |
| Answer» C. over | |
| 29. |
The walls and the roof of a room 10ft in length, 8 ft in width and 10 ft in height is to be painted. How much will it cost at 5 per square ft? |
| A. | Rs. 2,600 |
| B. | Rs. 2,000 |
| C. | Rs. 2,200 |
| D. | Rs. 2,400 |
| Answer» D. Rs. 2,400 | |
| 30. |
Two positive integers are in the ratio of 3 : 4. If the product of the two numbers is 1728, what is the value of the greater number?A. 36B. 38C. 48D. 72 |
| A. | D |
| B. | C |
| C. | B |
| D. | A |
| Answer» C. B | |
| 31. |
Select the option that is related to the third term in the same way as the second term is related to the first term.GROUND : INQQPZ :: REFINE : ? |
| A. | UBHEQD |
| B. | UBEHDQ |
| C. | TAIDPA |
| D. | TAHEPA |
| Answer» E. | |
| 32. |
The pressure distribution in the uniform wear theory is ________. |
| A. | directly proportional to radius |
| B. | directly proportional to the square of radius |
| C. | inversely proportional to radius |
| D. | inversely proportional to the square of radius |
| Answer» D. inversely proportional to the square of radius | |
| 33. |
To spice up electronics manufacturing within India, the government might begin by providing incentives to how many world smartphone makers? |
| A. | 3 |
| B. | 4 |
| C. | 5 |
| D. | 6 |
| E. | 7 |
| Answer» D. 6 | |
| 34. |
Which of the following has launched a miniature satellite 'RamanSat 2', designed by Aabhaas Sikka in September 2019? |
| A. | NASA |
| B. | SpaceX |
| C. | ISRO |
| D. | Roscosmos |
| E. | JAXA |
| Answer» B. SpaceX | |
| 35. |
The government is planning to launch CES with a revised methodology for FY22. What does 'E' stand for in CES? |
| A. | Environment |
| B. | Exchange |
| C. | Expenditure |
| D. | Execute |
| E. | Economy |
| Answer» D. Execute | |
| 36. |
Select the one which is different from the other three. |
| A. | January |
| B. | February |
| C. | July |
| D. | December |
| Answer» C. July | |
| 37. |
Which of the following leader of Kumaon took part in Banaras Session (1905 A.D.) of Indian National Congress? |
| A. | Pandit Hargovind Pant |
| B. | Sri Badri Dutt Pandey |
| C. | Swami Satya Dev |
| D. | None of the above |
| Answer» B. Sri Badri Dutt Pandey | |
| 38. |
Under the National Commission for Allied and Healthcare Professions Bill, 2020, each state will be having a separate state professional council with how many autonomous boards? |
| A. | 2 |
| B. | 3 |
| C. | 4 |
| D. | 5 |
| E. | 6 |
| Answer» D. 5 | |
| 39. |
Directions: The following seven (7) items consist of two statements, Statement I and Statement II. Examine these two statements carefully and select the correct answer using the code given below.Statement I: A person may suffer from tuberculosis if she/he frequently visits a crowded place.Statement II: Bacteria of tuberculosis spread through droplets by sneezing or coughing. |
| A. | Both the statements are individually true, and Statement II is the correct explanation of Statement I |
| B. | Both the statements are individually true, but Statement II is not the correct explanation of Statement I |
| C. | Statement I is true but Statement II is false |
| D. | Statement I is false but Statement II is true |
| Answer» E. | |
| 40. |
The latest issued bank notes in the denomination of ₹ 50 by RBI have what motif on their reverse side? |
| A. | Sanchi Stupa |
| B. | Stone chariot of Hampi |
| C. | Mangalyaan |
| D. | Red Fort |
| Answer» C. Mangalyaan | |
| 41. |
Two statements are given, followed by three conclusions numbered I, II and III. Assuming the statements to be true. Even if they seem to be at variance with commonly known facts, decide which of the conclusions logically follow(s) from the statements.Statement:All drums are sticks.Some drums are boxes.Conclusions: I. Some boxes are sticks.II. Some sticks are drums.III. All sticks are drums. |
| A. | Only conclusions I and II follow |
| B. | Only conclusions II and III follow |
| C. | Only conclusions I and III follow |
| D. | All the conclusions, I, II and III follow |
| Answer» B. Only conclusions II and III follow | |
| 42. |
The compound C6H12O4 contains________. |
| A. | 22 atoms per mole |
| B. | twice the mass percent of H as compared to the mass percent of C |
| C. | six times the mass percent of C as compared to the mass percent of H |
| D. | thrice the mass percent of H as compared to the mass percent of O |
| Answer» D. thrice the mass percent of H as compared to the mass percent of O | |
| 43. |
What is the sum (in Rs) of money which will become Rs 29160 at the rate of 8% per annum at compound interest in two years? |
| A. | 25000 |
| B. | 26000 |
| C. | 28000 |
| D. | 20000 |
| Answer» B. 26000 | |
| 44. |
The radii of the two circular faces of the frustum of a cone of height 21 cm are 5 cm and 3 cm. What is its volume in cm3? (π = 22/7) |
| A. | 1020 |
| B. | 1078 |
| C. | 1025 |
| D. | 1058 |
| Answer» C. 1025 | |
| 45. |
Select the correct indirect form of the given sentence."When will my parcel arrive?" Madhav asked. |
| A. | Madhav asked when his parcel would be arriving. |
| B. | Madhav asked when his parcel would arrive. |
| C. | Madhav asked when his parcel arrived. |
| D. | Madhav asked when his parcel will arrive. |
| Answer» C. Madhav asked when his parcel arrived. | |
| 46. |
Selecting and presenting stories and clippings from the newspaper that portray both men and women in non-traditional roles is an effective strategy to |
| A. | Promote gender constancy |
| B. | Encourage stereotypical gender roles |
| C. | Counter gender stereotypes |
| D. | Promote gender bias |
| Answer» D. Promote gender bias | |
| 47. |
SLR coaches with especially pink - coloured portion for lady passengers were placed into operation by: |
| A. | Southern Railway |
| B. | Southeast Coastal Railway |
| C. | Northeast Frontier Railway |
| D. | Northern Railway |
| Answer» D. Northern Railway | |
| 48. |
The Hall voltage, VH, for a thin copper plate of 0.1 mm carrying a current of 100 A with the flux density in the z-direction, Bz = 1 Wb/m2 and the Hall coefficient, RH = 7.4 × 10-11 m3/C, is |
| A. | 148 μV |
| B. | 111 μV |
| C. | 74 μV |
| D. | 37 μV |
| Answer» D. 37 μV | |
| 49. |
The population of a village increases by 5% yearly. If at present the population of the village is 4410, then what was the population before two years? |
| A. | 4420 |
| B. | 4430 |
| C. | 4440 |
| D. | 4000 |
| Answer» E. | |
| 50. |
Suppose f : R → R is defined by \({\rm{f}}\left( {\rm{x}} \right) = \frac{{{{\rm{x}}^2}}}{{1 + {{\rm{x}}^2}}}\) What is the range of the function? |
| A. | [0, 1) |
| B. | [0, 2] |
| C. | [-1, 1] |
| D. | [0, -1] |
| Answer» B. [0, 2] | |